CymitQuimica logo

CAS 1087784-36-8

:

4-(2-Pyridinylmethoxy)benzaldehyde oxime

Description:
4-(2-Pyridinylmethoxy)benzaldehyde oxime is an organic compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde with hydroxylamine. This compound features a benzaldehyde moiety substituted with a methoxy group linked to a pyridine ring, contributing to its unique chemical properties. The presence of the pyridine ring imparts basicity and potential coordination capabilities with metal ions, making it of interest in coordination chemistry. The oxime functional group can participate in various chemical reactions, including condensation and rearrangement, which may be useful in synthetic applications. Additionally, this compound may exhibit biological activity, making it a candidate for pharmaceutical research. Its solubility and stability in different solvents can vary, influencing its application in various chemical processes. Overall, 4-(2-Pyridinylmethoxy)benzaldehyde oxime is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c16-15-9-11-4-6-13(7-5-11)17-10-12-3-1-2-8-14-12/h1-9,16H,10H2
InChI key:InChIKey=AGUVUXAOCICWQD-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=N1)C2=CC=C(C=NO)C=C2
Synonyms:
  • 4-(2-Pyridinylmethoxy)benzaldehyde oxime
  • Benzaldehyde, 4-(2-pyridinylmethoxy)-, oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.