CAS 1087784-37-9

Methyl 5-(methoxycarbonyl)-2-furanacetate

Description:

Methyl 5-(methoxycarbonyl)-2-furanacetate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a methoxycarbonyl group, which is a functional group derived from methanol and carbonyl compounds, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of both the furan and ester functionalities suggests that it may exhibit interesting chemical behavior, including potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for various reactions, such as esterification and nucleophilic substitutions. Additionally, the compound's properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₀O₅

InChI: InChI=1S/C9H10O5/c1-12-8(10)5-6-3-4-7(14-6)9(11)13-2/h3-4H,5H2,1-2H3

InChI key: InChIKey=YWTRYDAONUXRNP-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1OC(C(OC)=O)=CC1

Synonyms:

• 2-Furanacetic acid, 5-(methoxycarbonyl)-, methyl ester
• Methyl 5-(methoxycarbonyl)-2-furanacetate

Methyl 5-(2-methoxy-2-oxoethyl)furan-2-carboxylate

CAS: 1087784-37-9

Versatile small molecule scaffold

Formula: C₉H₁₀O₅

Purity: Min. 95%

Molecular weight: 198.17 g/mol

Ref: 3D-MTB78437