CAS 1087784-45-9

4-(3-Pyridinylmethoxy)benzaldehyde oxime

Description:

4-(3-Pyridinylmethoxy)benzaldehyde oxime is an organic compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde with hydroxylamine. This compound features a benzaldehyde moiety substituted with a methoxy group linked to a pyridine ring, contributing to its unique chemical properties. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the oxime group can participate in various chemical reactions, including condensation and rearrangement. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in synthesis and biological assays. Additionally, the compound's structure suggests potential for hydrogen bonding and π-π interactions, influencing its reactivity and interactions with other molecules. Overall, 4-(3-Pyridinylmethoxy)benzaldehyde oxime is a versatile compound with applications in organic synthesis and potentially in pharmacology.

Formula: C₁₃H₁₂N₂O₂

InChI: InChI=1S/C13H12N2O2/c16-15-9-11-3-5-13(6-4-11)17-10-12-2-1-7-14-8-12/h1-9,16H,10H2

InChI key: InChIKey=JPSLDFHNSUOMQZ-UHFFFAOYSA-N

SMILES: O(CC=1C=CC=NC1)C2=CC=C(C=NO)C=C2

Synonyms:

• 4-(3-Pyridinylmethoxy)benzaldehyde oxime
• Benzaldehyde, 4-(3-pyridinylmethoxy)-, oxime