CAS 1087784-47-1

4-[[(Cyclopropylamino)carbonyl]amino]benzoic acid

Description:

4-[[(Cyclopropylamino)carbonyl]amino]benzoic acid, identified by its CAS number 1087784-47-1, is a chemical compound that features a benzoic acid core substituted with a cyclopropylamino group. This compound is characterized by its amine and carboxylic acid functional groups, which contribute to its potential as a bioactive molecule. The presence of the cyclopropyl group introduces unique steric and electronic properties, potentially influencing the compound's reactivity and interaction with biological targets. The compound may exhibit solubility in polar solvents due to the carboxylic acid group, while the aromatic ring can provide hydrophobic character. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts. Overall, 4-[[(Cyclopropylamino)carbonyl]amino]benzoic acid represents a compound of interest for further research and development in various chemical and biological applications.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c14-10(15)7-1-3-8(4-2-7)12-11(16)13-9-5-6-9/h1-4,9H,5-6H2,(H,14,15)(H2,12,13,16)

InChI key: InChIKey=FTXACWVNUJCGIO-UHFFFAOYSA-N

SMILES: N(C(NC1=CC=C(C(O)=O)C=C1)=O)C2CC2

Synonyms:

• 4-[[(Cyclopropylamino)carbonyl]amino]benzoic acid
• Benzoic acid, 4-[[(cyclopropylamino)carbonyl]amino]-

4-[(Cyclopropylcarbamoyl)amino]benzoic acid

CAS: 1087784-47-1

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 220.22 g/mol

Ref: 3D-MTB78447