CAS 1087784-54-0
:1,2,3,4-Tetrahydro-3-methyl-8-quinolinesulfonamide
Description:
1,2,3,4-Tetrahydro-3-methyl-8-quinolinesulfonamide is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline core and a sulfonamide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and sulfonamides, such as potential biological activity and solubility in polar solvents. The presence of the sulfonamide group often contributes to its pharmacological properties, making it of interest in medicinal chemistry. The tetrahydroquinoline structure may impart specific stereochemical configurations that can influence its interaction with biological targets. Additionally, this compound may exhibit moderate to high stability under standard laboratory conditions, although its reactivity can vary depending on the presence of functional groups and the surrounding environment. Overall, 1,2,3,4-Tetrahydro-3-methyl-8-quinolinesulfonamide represents a class of compounds that may have applications in drug development and therapeutic research, particularly in areas related to antimicrobial or anti-inflammatory activities.
Formula:C10H14N2O2S
InChI:InChI=1S/C10H14N2O2S/c1-7-5-8-3-2-4-9(15(11,13)14)10(8)12-6-7/h2-4,7,12H,5-6H2,1H3,(H2,11,13,14)
InChI key:InChIKey=UVJPSTJAUUZEKC-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C2C(CC(C)CN2)=CC=C1
Synonyms:- 1,2,3,4-Tetrahydro-3-methyl-8-quinolinesulfonamide
- 3-Methyl-1,2,3,4-tetrahydroquinoline-8-sulfonamide
- 8-Quinolinesulfonamide, 1,2,3,4-tetrahydro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.