CymitQuimica logo

CAS 1087784-55-1

:

N-[2-[4-(2-Chloroacetyl)-2-fluorophenyl]ethyl]acetamide

Description:
N-[2-[4-(2-Chloroacetyl)-2-fluorophenyl]ethyl]acetamide, with the CAS number 1087784-55-1, is a synthetic organic compound characterized by its complex structure, which includes a chloroacetyl group and a fluorophenyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloroacetyl group, which can participate in nucleophilic substitution reactions. The fluorine atom in the phenyl ring may influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The presence of halogen substituents can also affect the compound's stability and reactivity, making it of interest in various chemical and pharmaceutical research contexts. Overall, this compound's unique structural features suggest it may have specific applications in drug development or as a chemical intermediate.
Formula:C12H13ClFNO2
InChI:InChI=1S/C12H13ClFNO2/c1-8(16)15-5-4-9-2-3-10(6-11(9)14)12(17)7-13/h2-3,6H,4-5,7H2,1H3,(H,15,16)
InChI key:InChIKey=GCECXBQQNDAQDR-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=CC(F)=C(CCNC(C)=O)C=C1
Synonyms:
  • Acetamide, N-[2-[4-(2-chloroacetyl)-2-fluorophenyl]ethyl]-
  • N-[2-[4-(2-Chloroacetyl)-2-fluorophenyl]ethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.