CymitQuimica logo

CAS 1087784-64-2

:

5-Chloro-4-benzothiazolamine

Description:
5-Chloro-4-benzothiazolamine is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound features a chlorine atom at the 5-position and an amino group at the 4-position of the benzothiazole ring, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, depending on the specific conditions. The presence of the amino group allows for hydrogen bonding, which can influence its interactions in biological systems or chemical reactions. 5-Chloro-4-benzothiazolamine may be utilized in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its potential as a building block for synthesizing more complex molecules. Safety data should be reviewed for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, its unique structure and functional groups make it a compound of interest in chemical research and development.
Formula:C7H5ClN2S
InChI:InChI=1S/C7H5ClN2S/c8-4-1-2-5-7(6(4)9)10-3-11-5/h1-3H,9H2
InChI key:InChIKey=MYLQPGDEVXPATO-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC=C1Cl)SC=N2
Synonyms:
  • 4-Benzothiazolamine, 5-chloro-
  • 5-Chloro-4-benzothiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.