CAS 1087784-70-0: 5-(1-Piperazinylsulfonyl)-2-furancarboxamide
Description:5-(1-Piperazinylsulfonyl)-2-furancarboxamide is a chemical compound characterized by its unique structural features, which include a furan ring, a piperazine moiety, and a sulfonyl group. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the piperazine and sulfonyl groups that enhance its hydrophilicity. It may also demonstrate biological activity, potentially acting as a pharmacophore in medicinal chemistry, particularly in the development of therapeutic agents. The presence of the furan ring suggests potential reactivity in various chemical reactions, including electrophilic substitutions. Additionally, the compound's molecular structure may confer specific interactions with biological targets, making it of interest in drug discovery and development. Its CAS number, 1087784-70-0, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C9H13N3O4S
InChI:InChI=1S/C9H13N3O4S/c10-9(13)7-1-2-8(16-7)17(14,15)12-5-3-11-4-6-12/h1-2,11H,3-6H2,(H2,10,13)
InChI key:InChIKey=OXIAPQGSCKWZLP-UHFFFAOYSA-N
SMILES:O=C(N)C=1OC(=CC1)S(=O)(=O)N2CCNCC2
- Synonyms:
- 2-Furancarboxamide, 5-(1-piperazinylsulfonyl)-
- 5-(1-Piperazinylsulfonyl)-2-furancarboxamide
