CymitQuimica logo

CAS 1087784-72-2

:

4-[(Methoxyamino)sulfonyl]benzoic acid

Description:
4-[(Methoxyamino)sulfonyl]benzoic acid, identified by its CAS number 1087784-72-2, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with a methoxyamino and a sulfonyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid group and the amino group, which can participate in hydrogen bonding. The methoxy group contributes to its solubility in organic solvents, while the sulfonyl group enhances its reactivity and potential for forming sulfonamide derivatives. The compound may be utilized in various applications, including pharmaceuticals, where it could serve as an intermediate in the synthesis of biologically active molecules. Its structural features suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both polar and non-polar groups in its structure may influence its behavior in different chemical environments, affecting its stability and reactivity.
Formula:C8H9NO5S
InChI:InChI=1S/C8H9NO5S/c1-14-9-15(12,13)7-4-2-6(3-5-7)8(10)11/h2-5,9H,1H3,(H,10,11)
InChI key:InChIKey=MGOWUCRXWXVRCO-UHFFFAOYSA-N
SMILES:S(NOC)(=O)(=O)C1=CC=C(C(O)=O)C=C1
Synonyms:
  • Benzoic acid, 4-[(methoxyamino)sulfonyl]-
  • 4-[(Methoxyamino)sulfonyl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.