
CAS 1087788-61-1
:2,2,2-Trifluoroethyl 2,3-dihydro-1H-indole-1-carboxylate
Description:
2,2,2-Trifluoroethyl 2,3-dihydro-1H-indole-1-carboxylate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and an indole moiety. This compound typically exhibits properties associated with both the indole and ester functional groups, such as moderate polarity and potential for hydrogen bonding due to the presence of the carboxylate group. The trifluoroethyl substituent imparts significant lipophilicity and can influence the compound's reactivity and interaction with biological systems. It may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The presence of fluorine atoms often enhances metabolic stability and alters the compound's solubility profile. Additionally, the indole structure is known for its role in various biological activities, including neurotransmitter function and enzyme inhibition. Overall, this compound's characteristics make it a valuable candidate for further research in drug development and chemical synthesis.
Formula:C11H10F3NO2
InChI:InChI=1S/C11H10F3NO2/c12-11(13,14)7-17-10(16)15-6-5-8-3-1-2-4-9(8)15/h1-4H,5-7H2
InChI key:InChIKey=CJGSHZBUKLAXDO-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)(=O)N1C=2C(CC1)=CC=CC2
Synonyms:- 1H-Indole-1-carboxylic acid, 2,3-dihydro-, 2,2,2-trifluoroethyl ester
- 2,2,2-Trifluoroethyl 2,3-dihydro-1H-indole-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.