CAS 1087788-67-7
:2,2,2-Trifluoroethyl N-(5-chloro-2-pyridinyl)carbamate
Description:
2,2,2-Trifluoroethyl N-(5-chloro-2-pyridinyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group attached to a pyridine ring. This compound is typically a white to off-white solid and is known for its stability under standard conditions. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the presence of the hydrophobic trifluoroethyl moiety. The presence of the chloro substituent on the pyridine ring can influence its reactivity and biological activity, making it of interest in various fields, including agrochemicals and pharmaceuticals. The trifluoroethyl group contributes to the compound's lipophilicity, potentially enhancing its ability to penetrate biological membranes. As with many carbamates, it may exhibit insecticidal or herbicidal properties, making it relevant in agricultural applications. Safety data should be consulted for handling and exposure guidelines, as compounds of this nature can pose health risks.
Formula:C8H6ClF3N2O2
InChI:InChI=1S/C8H6ClF3N2O2/c9-5-1-2-6(13-3-5)14-7(15)16-4-8(10,11)12/h1-3H,4H2,(H,13,14,15)
InChI key:InChIKey=PVZNGDSAWRGOII-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC=C(Cl)C=N1
Synonyms:- 2,2,2-Trifluoroethyl N-(5-chloro-2-pyridinyl)carbamate
- Carbamic acid, N-(5-chloro-2-pyridinyl)-, 2,2,2-trifluoroethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.