CAS 1087788-76-8

2,2,2-Trifluoroethyl N-[3-(1-methylethyl)phenyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[3-(1-methylethyl)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically used in the field of agrochemicals, particularly as a pesticide or herbicide, due to its ability to inhibit specific biological processes in target organisms. The presence of the trifluoroethyl group enhances its lipophilicity, potentially improving its absorption and efficacy in biological systems. The phenyl ring, substituted with an isopropyl group, contributes to its overall stability and reactivity. Additionally, the carbamate moiety is known for its role in the inhibition of enzymes such as acetylcholinesterase, which is crucial for neurotransmission. Overall, this compound exhibits properties that make it valuable in agricultural applications, while also necessitating careful handling due to its potential environmental and health impacts. As with many chemical substances, understanding its behavior in various conditions is essential for safe and effective use.

Formula: C₁₂H₁₄F₃NO₂

InChI: InChI=1S/C12H14F3NO2/c1-8(2)9-4-3-5-10(6-9)16-11(17)18-7-12(13,14)15/h3-6,8H,7H2,1-2H3,(H,16,17)

InChI key: InChIKey=WBOULLDTXBVJEJ-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC(C(C)C)=CC=C1

Synonyms:

• Carbamic acid, N-[3-(1-methylethyl)phenyl]-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-[3-(1-methylethyl)phenyl]carbamate

2,2,2-Trifluoroethyl N-[3-(propan-2-yl)phenyl]carbamate

CAS: 1087788-76-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄F₃NO₂

Purity: Min. 95%

Molecular weight: 261.24 g/mol

Ref: 3D-MTB78876