CAS 1087788-78-0

2,2,2-Trifluoroethyl N-(2,2-difluoro-1,3-benzodioxol-5-yl)carbamate

Description:

2,2,2-Trifluoroethyl N-(2,2-difluoro-1,3-benzodioxol-5-yl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a benzodioxole moiety. This compound is notable for its potential applications in pharmaceuticals and agrochemicals, particularly due to the presence of fluorine atoms that can enhance biological activity and stability. The trifluoroethyl group contributes to its lipophilicity, which can influence its absorption and distribution in biological systems. The carbamate functional group is known for its reactivity and can participate in various chemical reactions, making this compound versatile in synthetic chemistry. Additionally, the presence of the benzodioxole structure may impart specific pharmacological properties, as this scaffold is often associated with various biological activities. Overall, 2,2,2-Trifluoroethyl N-(2,2-difluoro-1,3-benzodioxol-5-yl)carbamate represents a complex and interesting compound within the realm of organic chemistry, with potential implications in medicinal chemistry and material science.

Formula: C₁₀H₆F₅NO₄

InChI: InChI=1S/C10H6F5NO4/c11-9(12,13)4-18-8(17)16-5-1-2-6-7(3-5)20-10(14,15)19-6/h1-3H,4H2,(H,16,17)

InChI key: InChIKey=VDJQRGMVIGOVIM-UHFFFAOYSA-N

SMILES: FC1(F)OC=2C(=CC(NC(OCC(F)(F)F)=O)=CC2)O1

Synonyms:

• Carbamic acid, N-(2,2-difluoro-1,3-benzodioxol-5-yl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(2,2-difluoro-1,3-benzodioxol-5-yl)carbamate

2,2,2-Trifluoroethyl N-(2,2-difluoro-1,3-dioxaindan-5-yl)carbamate

CAS: 1087788-78-0

Versatile small molecule scaffold

Formula: C₁₀H₆F₅NO₄

Purity: Min. 95%

Molecular weight: 299.15 g/mol

Ref: 3D-MTB78878