
CAS 1087788-83-7
:2,2,2-Trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate
Description:
2,2,2-Trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a phenyl ring substituted with a trifluoromethyl group. This compound belongs to the class of carbamates, which are esters or salts of carbamic acid. It typically exhibits properties such as high thermal stability and resistance to hydrolysis, making it suitable for various applications in agrochemicals and pharmaceuticals. The presence of multiple fluorine atoms contributes to its lipophilicity and potential bioactivity, influencing its interaction with biological systems. Additionally, the trifluoromethyl groups enhance the compound's potency and selectivity in biological applications. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated compounds. Overall, 2,2,2-Trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate represents a significant interest in chemical research and development, particularly in the fields of crop protection and medicinal chemistry.
Formula:C10H7F6NO2
InChI:InChI=1S/C10H7F6NO2/c11-9(12,13)5-19-8(18)17-7-3-1-2-6(4-7)10(14,15)16/h1-4H,5H2,(H,17,18)
InChI key:InChIKey=GPEOZDBOTBZPFU-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- Carbamic acid, N-[3-(trifluoromethyl)phenyl]-, 2,2,2-trifluoroethyl ester
- 2,2,2-Trifluoroethyl N-[3-(trifluoromethyl)phenyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.