CymitQuimica logo

CAS 1087788-85-9

:

2,2,2-Trifluoroethyl N-(2,4-dimethoxyphenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(2,4-dimethoxyphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group linked to a substituted phenyl ring. The presence of the trifluoroethyl group imparts notable properties such as increased lipophilicity and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The dimethoxy substitution on the phenyl ring enhances the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound is typically synthesized through a reaction involving a carbamate formation process, which may include the use of specific reagents and conditions to ensure the desired substitution pattern. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 2,2,2-Trifluoroethyl N-(2,4-dimethoxyphenyl)carbamate represents a class of compounds that may exhibit significant biological activity, warranting further investigation for potential applications.
Formula:C11H12F3NO4
InChI:InChI=1S/C11H12F3NO4/c1-17-7-3-4-8(9(5-7)18-2)15-10(16)19-6-11(12,13)14/h3-5H,6H2,1-2H3,(H,15,16)
InChI key:InChIKey=LXAHRHVUWGWKLI-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(OC)C=C(OC)C=C1
Synonyms:
  • Carbamic acid, N-(2,4-dimethoxyphenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-(2,4-dimethoxyphenyl)carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.