CymitQuimica logo

CAS 1087788-90-6

:

2,2,2-Trifluoroethyl N-[4-(aminocarbonyl)phenyl]carbamate

Description:
2,2,2-Trifluoroethyl N-[4-(aminocarbonyl)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. The presence of the trifluoroethyl moiety imparts significant lipophilicity and can influence the compound's biological activity and stability. The aminocarbonyl group attached to the phenyl ring suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry. This compound may exhibit specific pharmacological properties, potentially acting as an inhibitor or modulator in various biological pathways. Its molecular interactions could be influenced by the electron-withdrawing nature of the trifluoroethyl group, which can affect the acidity and basicity of the compound. Additionally, the compound's solubility, melting point, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 2,2,2-Trifluoroethyl N-[4-(aminocarbonyl)phenyl]carbamate represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C10H9F3N2O3
InChI:InChI=1S/C10H9F3N2O3/c11-10(12,13)5-18-9(17)15-7-3-1-6(2-4-7)8(14)16/h1-4H,5H2,(H2,14,16)(H,15,17)
InChI key:InChIKey=HKMWLESQXAPVIG-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC=C(C(N)=O)C=C1
Synonyms:
  • Carbamic acid, N-[4-(aminocarbonyl)phenyl]-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-[4-(aminocarbonyl)phenyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.