CAS 1087788-94-0

2,2,2-Trifluoroethyl 3,4-dihydro-1(2H)-quinolinecarboxylate

Description:

2,2,2-Trifluoroethyl 3,4-dihydro-1(2H)-quinolinecarboxylate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a quinoline derivative. This compound typically exhibits properties associated with both fluorinated compounds and heterocycles. The presence of the trifluoroethyl group often imparts increased lipophilicity and stability, making it of interest in medicinal chemistry and material science. The quinoline moiety contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. The compound may also display specific reactivity patterns due to the carboxylate functional group, which can participate in various chemical reactions, including esterification and nucleophilic substitutions. Its solubility, melting point, and boiling point would depend on the specific interactions of its functional groups and the overall molecular structure. As with many fluorinated compounds, it may exhibit unique spectral characteristics in NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.

Formula: C₁₂H₁₂F₃NO₂

InChI: InChI=1S/C12H12F3NO2/c13-12(14,15)8-18-11(17)16-7-3-5-9-4-1-2-6-10(9)16/h1-2,4,6H,3,5,7-8H2

InChI key: InChIKey=SINLVYLRGYTDGA-UHFFFAOYSA-N

SMILES: C(OCC(F)(F)F)(=O)N1C=2C(CCC1)=CC=CC2

Synonyms:

• 1(2H)-Quinolinecarboxylic acid, 3,4-dihydro-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl 3,4-dihydro-1(2H)-quinolinecarboxylate