CAS 1087788-98-4

2,2,2-Trifluoroethyl N-(4-fluoro-2-methylphenyl)carbamate

Description:

2,2,2-Trifluoroethyl N-(4-fluoro-2-methylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a white to off-white solid at room temperature and is known for its stability under standard conditions. It exhibits moderate solubility in organic solvents, while its solubility in water is generally low due to the presence of hydrophobic fluorinated groups. The trifluoroethyl moiety contributes to its lipophilicity, which can influence its biological activity and interaction with various biological systems. The presence of the carbamate group suggests potential applications in agrochemicals or pharmaceuticals, as carbamates are often associated with insecticidal and herbicidal properties. Additionally, the fluorinated aromatic ring may enhance the compound's metabolic stability and bioactivity. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit unique toxicological profiles.

Formula: C₁₀H₉F₄NO₂

InChI: InChI=1S/C10H9F4NO2/c1-6-4-7(11)2-3-8(6)15-9(16)17-5-10(12,13)14/h2-4H,5H2,1H3,(H,15,16)

InChI key: InChIKey=YFZVDAWTFFZTFN-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=C(C)C=C(F)C=C1

Synonyms:

• 2,2,2-Trifluoroethyl N-(4-fluoro-2-methylphenyl)carbamate
• 2,2,2-Trifluoroethyl 4-fluoro-2-methylphenylcarbamate
• Carbamic acid, N-(4-fluoro-2-methylphenyl)-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-(4-fluoro-2-methylphenyl)carbamate

CAS: 1087788-98-4

Versatile small molecule scaffold

Formula: C₁₀H₉F₄NO₂

Purity: Min. 95%

Molecular weight: 251.18 g/mol

Ref: 3D-MTB78898