CAS 1087788-99-5

2,2,2-Trifluoroethyl N-(4-iodophenyl)carbamate

Description:

2,2,2-Trifluoroethyl N-(4-iodophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group attached to a phenyl ring substituted with an iodine atom. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to its polar functional groups. The presence of the trifluoroethyl moiety imparts notable lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The iodine substitution on the phenyl ring can enhance the compound's reactivity and may also affect its electronic properties. Additionally, the carbamate group is known for its potential applications in agrochemicals and pharmaceuticals, often serving as a protective group or a bioactive moiety. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique characteristics make it a subject of interest in various chemical and biological studies.

Formula: C₉H₇F₃INO₂

InChI: InChI=1S/C9H7F3INO2/c10-9(11,12)5-16-8(15)14-7-3-1-6(13)2-4-7/h1-4H,5H2,(H,14,15)

InChI key: InChIKey=WCHXANCPODAGPF-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC=C(I)C=C1

Synonyms:

• Carbamic acid, N-(4-iodophenyl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl 4-iodophenylcarbamate
• 2,2,2-Trifluoroethyl N-(4-iodophenyl)carbamate