
CAS 1087789-16-9
:3-(1-Methylethyl)-3-azabicyclo[3.2.1]octan-8-one
Description:
3-(1-Methylethyl)-3-azabicyclo[3.2.1]octan-8-one, also known by its CAS number 1087789-16-9, is a bicyclic compound featuring a nitrogen atom within its ring structure, classifying it as a bicyclic amine. This compound is characterized by its unique bicyclic framework, which consists of a seven-membered ring fused to a five-membered ring, incorporating a ketone functional group at the 8-position. The presence of the isopropyl group (1-methylethyl) at the 3-position contributes to its steric properties and may influence its reactivity and interaction with biological systems. The nitrogen atom in the bicyclic structure can participate in hydrogen bonding, potentially affecting its solubility and pharmacological properties. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for practical applications.
Formula:C10H17NO
InChI:InChI=1S/C10H17NO/c1-7(2)11-5-8-3-4-9(6-11)10(8)12/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=PKRSHJSQEQZFSE-UHFFFAOYSA-N
SMILES:O=C1C2CN(C(C)C)CC1CC2
Synonyms:- 3-Azabicyclo[3.2.1]octan-8-one, 3-(1-methylethyl)-
- 3-(1-Methylethyl)-3-azabicyclo[3.2.1]octan-8-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.