CymitQuimica logo

CAS 1087791-94-3

:

2-Chloro-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylacetamide

Description:
2-Chloro-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylacetamide is a chemical compound characterized by its complex structure, which includes a chloro substituent, an oxadiazole ring, and a cyclopropyl group. This compound typically exhibits properties associated with both its aromatic and heterocyclic components, potentially influencing its solubility, reactivity, and biological activity. The presence of the oxadiazole moiety suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The chloro groups may enhance lipophilicity and affect the compound's pharmacokinetics. Additionally, the cyclopropyl group can introduce unique steric and electronic effects, which may be beneficial in modulating the compound's interaction with enzymes or receptors. Overall, the characteristics of this compound make it a subject of interest in various fields, including drug discovery and materials science, although specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise details.
Formula:C14H13Cl2N3O2
InChI:InChI=1S/C14H13Cl2N3O2/c15-7-13(20)19(11-5-6-11)8-12-17-18-14(21-12)9-1-3-10(16)4-2-9/h1-4,11H,5-8H2
InChI key:InChIKey=ISEUJZDGUADLLF-UHFFFAOYSA-N
SMILES:N(CC=1OC(=NN1)C2=CC=C(Cl)C=C2)(C(CCl)=O)C3CC3
Synonyms:
  • 2-Chloro-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropylacetamide
  • Acetamide, 2-chloro-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.