
CAS 1087791-99-8
:2-Chloro-N-[[2-(4-morpholinylsulfonyl)phenyl]methyl]acetamide
Description:
2-Chloro-N-[[2-(4-morpholinylsulfonyl)phenyl]methyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, an acetamide moiety, and a morpholinylsulfonyl phenyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the acetamide and morpholine functionalities, which can engage in hydrogen bonding. The chloro substituent may influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. The morpholine ring contributes to the compound's overall stability and may enhance its interaction with biological targets. Additionally, the sulfonyl group can impart unique electronic properties, affecting the compound's reactivity and solubility. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific physical properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise characterization.
Formula:C13H17ClN2O4S
InChI:InChI=1S/C13H17ClN2O4S/c14-9-13(17)15-10-11-3-1-2-4-12(11)21(18,19)16-5-7-20-8-6-16/h1-4H,5-10H2,(H,15,17)
InChI key:InChIKey=KSFIRGQJUIMIAA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(CNC(CCl)=O)C=CC=C1)N2CCOCC2
Synonyms:- 2-Chloro-N-[[2-(4-morpholinylsulfonyl)phenyl]methyl]acetamide
- Acetamide, 2-chloro-N-[[2-(4-morpholinylsulfonyl)phenyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.