CymitQuimica logo

CAS 1087792-07-1

:

1,2,3,4-Tetrahydro-N,1-dimethylpyrrolo[1,2-a]pyrazine-6-carboxamide

Description:
1,2,3,4-Tetrahydro-N,1-dimethylpyrrolo[1,2-a]pyrazine-6-carboxamide is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrole and pyrazine moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and contains a carboxamide functional group, which contributes to its potential solubility and reactivity. The dimethyl substitution on the nitrogen atom enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetic properties. The presence of multiple nitrogen atoms within the structure may also impart unique electronic properties, making it of interest in medicinal chemistry and drug design. Additionally, the compound's structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation. Overall, the compound's unique structural characteristics and functional groups position it as a candidate for further research in chemical and biological applications.
Formula:C10H15N3O
InChI:InChI=1S/C10H15N3O/c1-7-8-3-4-9(10(14)11-2)13(8)6-5-12-7/h3-4,7,12H,5-6H2,1-2H3,(H,11,14)
InChI key:InChIKey=OYRGMQSSJKXOSC-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1N2C(=CC1)C(C)NCC2
Synonyms:
  • 1-Methyl-1,2,3,4-tetrahydropyrrolo[1,2-〈a]pyrazine-6-carboxylic acid methylamide
  • 1-Methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid methylamide
  • Pyrrolo[1,2-a]pyrazine-6-carboxamide, 1,2,3,4-tetrahydro-N,1-dimethyl-
  • 1,2,3,4-Tetrahydro-N,1-dimethylpyrrolo[1,2-a]pyrazine-6-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.