CymitQuimica logo

CAS 1087792-11-7

:

1-[[5-(3-Bromophenyl)-2-thienyl]methyl]piperazine

Description:
1-[[5-(3-Bromophenyl)-2-thienyl]methyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a thienyl group substituted with a bromophenyl moiety. This compound typically exhibits properties associated with both piperazine derivatives and thienyl compounds, such as potential biological activity, including interactions with neurotransmitter systems. The presence of the bromine atom may influence its lipophilicity and reactivity, potentially enhancing its pharmacological profile. The compound is likely to be a solid at room temperature, with solubility varying depending on the solvent used, often showing better solubility in organic solvents. Its molecular structure suggests it may participate in hydrogen bonding and π-π stacking interactions, which could be relevant in biological systems. As with many synthetic organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C15H17BrN2S
InChI:InChI=1S/C15H17BrN2S/c16-13-3-1-2-12(10-13)15-5-4-14(19-15)11-18-8-6-17-7-9-18/h1-5,10,17H,6-9,11H2
InChI key:InChIKey=HXAXVUDGLWEFNX-UHFFFAOYSA-N
SMILES:C(C=1SC(=CC1)C2=CC(Br)=CC=C2)N3CCNCC3
Synonyms:
  • 1-[[5-(3-Bromophenyl)-2-thienyl]methyl]piperazine
  • Piperazine, 1-[[5-(3-bromophenyl)-2-thienyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.