CAS 1087792-16-2

5-[[(1,1-Dimethylethyl)amino]sulfonyl]-2-furancarboxylic acid

Description:

5-[[(1,1-Dimethylethyl)amino]sulfonyl]-2-furancarboxylic acid, identified by its CAS number 1087792-16-2, is a chemical compound characterized by its unique structural features, including a furan ring and a sulfonamide functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid and the sulfonamide moiety. It is likely to be soluble in polar solvents, given the presence of these functional groups, which can engage in hydrogen bonding. The dimethylamino group contributes to its potential basicity and may influence its reactivity and interaction with biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a class of sulfonamide derivatives that may exhibit interesting biological or chemical properties.

Formula: C₉H₁₃NO₅S

InChI: InChI=1S/C9H13NO5S/c1-9(2,3)10-16(13,14)7-5-4-6(15-7)8(11)12/h4-5,10H,1-3H3,(H,11,12)

InChI key: InChIKey=GNFFMTLNRGEWKJ-UHFFFAOYSA-N

SMILES: S(NC(C)(C)C)(=O)(=O)C=1OC(C(O)=O)=CC1

Synonyms:

• 2-Furancarboxylic acid, 5-[[(1,1-dimethylethyl)amino]sulfonyl]-
• 5-[[(1,1-Dimethylethyl)amino]sulfonyl]-2-furancarboxylic acid