CAS 1087792-17-3
:N-[(3-Aminophenyl)methyl]-N-ethyl-2,2,2-trifluoroacetamide
Description:
N-[(3-Aminophenyl)methyl]-N-ethyl-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes an amine group, an ethyl group, and a trifluoroacetamide moiety. This compound features a phenyl ring substituted with an amino group at the meta position, contributing to its potential biological activity. The presence of trifluoroacetyl groups enhances its lipophilicity and may influence its interaction with biological targets. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethyl groups can impart unique electronic properties, potentially affecting the compound's reactivity and stability. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to specific pharmacological effects. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and materials science.
Formula:C11H13F3N2O
InChI:InChI=1S/C11H13F3N2O/c1-2-16(10(17)11(12,13)14)7-8-4-3-5-9(15)6-8/h3-6H,2,7,15H2,1H3
InChI key:InChIKey=ZIXBGSZHILOFCT-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)(CC1=CC(N)=CC=C1)CC
Synonyms:- N-[(3-Aminophenyl)methyl]-N-ethyl-2,2,2-trifluoroacetamide
- Acetamide, N-[(3-aminophenyl)methyl]-N-ethyl-2,2,2-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.