CymitQuimica logo

CAS 1087792-26-4

:

1-Ethyl-1H-indole-3-carboxamide

Description:
1-Ethyl-1H-indole-3-carboxamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features an ethyl group at the 1-position and a carboxamide functional group at the 3-position of the indole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the carboxamide group suggests potential for hydrogen bonding, influencing its reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry and pharmacology due to its structural similarity to various bioactive molecules. Its specific applications and biological activities would depend on further research, including studies on its pharmacokinetics, toxicity, and potential therapeutic effects. As with any chemical substance, proper handling and safety precautions should be observed, especially in laboratory settings.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-2-13-7-9(11(12)14)8-5-3-4-6-10(8)13/h3-7H,2H2,1H3,(H2,12,14)
InChI key:InChIKey=WCVIUFGHYAXGMS-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=2C(N(CC)C1)=CC=CC2
Synonyms:
  • 1H-Indole-3-carboxamide, 1-ethyl-
  • 1-Ethyl-1H-indole-3-carboxamide
Found 0 products.