CAS 1087792-44-6

1-(Aminosulfonyl)-4-piperidinecarboxamide

Description:

1-(Aminosulfonyl)-4-piperidinecarboxamide, identified by its CAS number 1087792-44-6, is a chemical compound characterized by the presence of a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an aminosulfonyl group, indicating the presence of a sulfonamide functional group, which is known for its biological activity and potential therapeutic applications. The carboxamide functional group contributes to its solubility and reactivity, making it a versatile molecule in medicinal chemistry. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, which can influence their interaction with biological systems. The presence of both amine and sulfonyl groups suggests potential for hydrogen bonding, enhancing solubility in polar solvents. Additionally, the structural features may confer specific pharmacological properties, making it a candidate for further investigation in drug development. Overall, this compound's unique functional groups and structural characteristics position it as an interesting subject for research in various chemical and biological applications.

Formula: C₆H₁₃N₃O₃S

InChI: InChI=1S/C6H13N3O3S/c7-6(10)5-1-3-9(4-2-5)13(8,11)12/h5H,1-4H2,(H2,7,10)(H2,8,11,12)

InChI key: InChIKey=PUULZNGBFUGUFG-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)N1CCC(C(N)=O)CC1

Synonyms:

• 4-Piperidinecarboxamide, 1-(aminosulfonyl)-
• 1-(Aminosulfonyl)-4-piperidinecarboxamide