CymitQuimica logo

CAS 1087792-45-7

:

3-(4-Pyridinylmethoxy)benzaldehyde oxime

Description:
3-(4-Pyridinylmethoxy)benzaldehyde oxime is an organic compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde with hydroxylamine. This compound features a benzaldehyde moiety linked to a pyridine ring through a methoxy group, contributing to its unique chemical properties. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the oxime group can participate in various chemical reactions, including condensation and rearrangement. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the compound's structure suggests potential applications in organic synthesis and as a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c16-15-9-12-2-1-3-13(8-12)17-10-11-4-6-14-7-5-11/h1-9,16H,10H2
InChI key:InChIKey=QJAUVMPFIUMOLH-UHFFFAOYSA-N
SMILES:O(CC=1C=CN=CC1)C2=CC(C=NO)=CC=C2
Synonyms:
  • Benzaldehyde, 3-(4-pyridinylmethoxy)-, oxime
  • 3-(4-Pyridinylmethoxy)benzaldehyde oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.