CymitQuimica logo

CAS 1087792-51-5

:

N-[(6-Methoxy-2-naphthalenyl)methyl]-1H-imidazole-1-carboxamide

Description:
N-[(6-Methoxy-2-naphthalenyl)methyl]-1H-imidazole-1-carboxamide is a chemical compound characterized by its unique structure, which includes an imidazole ring and a naphthalene moiety. The presence of the methoxy group on the naphthalene enhances its lipophilicity, potentially influencing its biological activity and solubility properties. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its imidazole core is known for its role in various biological systems, often acting as a scaffold for drug development. The carboxamide functional group contributes to its hydrogen bonding capabilities, which can affect its interaction with biological targets. The compound's molecular weight, melting point, and solubility characteristics would be essential for understanding its behavior in different environments, particularly in biological systems. Additionally, the compound's CAS number, 1087792-51-5, allows for precise identification and retrieval of information in chemical databases, facilitating research and development efforts. Overall, this compound's structural features suggest potential utility in pharmaceutical applications, warranting further investigation.
Formula:C16H15N3O2
InChI:InChI=1S/C16H15N3O2/c1-21-15-5-4-13-8-12(2-3-14(13)9-15)10-18-16(20)19-7-6-17-11-19/h2-9,11H,10H2,1H3,(H,18,20)
InChI key:InChIKey=WKQBJWPRRTVIEM-UHFFFAOYSA-N
SMILES:C(NC(=O)N1C=CN=C1)C2=CC3=C(C=C(OC)C=C3)C=C2
Synonyms:
  • N-[(6-Methoxy-2-naphthalenyl)methyl]-1H-imidazole-1-carboxamide
  • 1H-Imidazole-1-carboxamide, N-[(6-methoxy-2-naphthalenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.