CymitQuimica logo

CAS 1087792-63-9

:

Methyl 2,5-dimethyl-4-(1-piperazinylsulfonyl)-3-furancarboxylate

Description:
Methyl 2,5-dimethyl-4-(1-piperazinylsulfonyl)-3-furancarboxylate is a chemical compound characterized by its unique structure, which includes a furan ring, a sulfonyl group, and a piperazine moiety. This compound typically exhibits properties associated with both furan derivatives and piperazine-based compounds, such as potential biological activity and solubility in organic solvents. The presence of the sulfonyl group may enhance its reactivity and influence its interaction with biological targets. Methyl esters, like this compound, often show moderate to high lipophilicity, which can affect their pharmacokinetic properties. Additionally, the dimethyl substitutions on the furan ring may contribute to steric hindrance, potentially impacting the compound's reactivity and binding affinity in biological systems. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications, although specific biological activities would require further investigation.
Formula:C12H18N2O5S
InChI:InChI=1S/C12H18N2O5S/c1-8-10(12(15)18-3)11(9(2)19-8)20(16,17)14-6-4-13-5-7-14/h13H,4-7H2,1-3H3
InChI key:InChIKey=AUGGYXRPGPQYCZ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C(C(OC)=O)=C(C)OC1C)N2CCNCC2
Synonyms:
  • 3-Furancarboxylic acid, 2,5-dimethyl-4-(1-piperazinylsulfonyl)-, methyl ester
  • Methyl 2,5-dimethyl-4-(1-piperazinylsulfonyl)-3-furancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.