CAS 1087792-65-1

4-[[(2-Hydroxypropyl)amino]sulfonyl]benzoic acid

Description:

4-[[(2-Hydroxypropyl)amino]sulfonyl]benzoic acid, identified by its CAS number 1087792-65-1, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with a sulfonamide group. This compound features a hydroxypropyl group attached to an amino group, which contributes to its solubility and potential biological activity. The sulfonyl group enhances its polarity, making it more soluble in polar solvents. Typically, compounds of this nature may exhibit properties such as being a potential pharmaceutical agent, with applications in medicinal chemistry due to their ability to interact with biological targets. The presence of both acidic (carboxylic acid) and basic (amino) functional groups suggests that it can participate in various chemical reactions, including acid-base interactions. Additionally, the hydroxypropyl group may influence the compound's pharmacokinetics and bioavailability. Overall, this compound's unique structure positions it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₀H₁₃NO₅S

InChI: InChI=1S/C10H13NO5S/c1-7(12)6-11-17(15,16)9-4-2-8(3-5-9)10(13)14/h2-5,7,11-12H,6H2,1H3,(H,13,14)

InChI key: InChIKey=XLQRMFVBYXXSRR-UHFFFAOYSA-N

SMILES: S(NCC(C)O)(=O)(=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• Benzoic acid, 4-[[(2-hydroxypropyl)amino]sulfonyl]-
• 4-[[(2-Hydroxypropyl)amino]sulfonyl]benzoic acid

4-[(2-Hydroxypropyl)sulfamoyl]benzoic acid

CAS: 1087792-65-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₅S

Purity: Min. 95%

Molecular weight: 259.28 g/mol

Ref: 3D-MTB79265