CAS 1087797-84-9

Carbamic acid, N-(3,4-dimethylphenyl)-, 2,2,2-trifluoroethyl ester

Description:

Carbamic acid, N-(3,4-dimethylphenyl)-, 2,2,2-trifluoroethyl ester is an organic compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a 3,4-dimethylphenyl group, indicating the presence of two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics. The trifluoroethyl ester moiety introduces significant electronegativity due to the presence of three fluorine atoms, which can enhance the compound's lipophilicity and influence its reactivity and interaction with biological systems. The presence of the trifluoroethyl group may also impart unique properties such as increased stability and altered solubility in various solvents. This compound may be of interest in medicinal chemistry and agrochemicals due to its potential biological activity, although specific applications would depend on further research into its pharmacological properties and mechanisms of action. Safety and handling considerations are essential, as with many chemical substances, particularly those containing fluorinated groups.

Formula: C₁₁H₁₂F₃NO₂

InChI: InChI=1S/C11H12F3NO2/c1-7-3-4-9(5-8(7)2)15-10(16)17-6-11(12,13)14/h3-5H,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=OJXBGWDPMIESKY-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC(C)=C(C)C=C1

Synonyms:

• Carbamic acid, N-(3,4-dimethylphenyl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(3,4-dimethylphenyl)carbamate

2,2,2-Trifluoroethyl N-(3,4-dimethylphenyl)carbamate

CAS: 1087797-84-9

Versatile small molecule scaffold

Formula: C₁₁H₁₂F₃NO₂

Purity: Min. 95%

Molecular weight: 247.21 g/mol

Ref: 3D-MTB79784