CAS 1087797-93-0

2,2,2-Trifluoroethyl N-(2,6-difluorophenyl)carbamate

Description:

2,2,2-Trifluoroethyl N-(2,6-difluorophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is notable for its fluorinated moieties, which can enhance its lipophilicity and biological activity. The presence of the difluorophenyl group contributes to its potential applications in agrochemicals or pharmaceuticals, as fluorinated compounds often exhibit improved metabolic stability and bioactivity. The carbamate functional group is known for its role in various biological activities, including insecticidal and herbicidal properties. Additionally, the trifluoroethyl group can influence the compound's solubility and volatility. The compound's stability, reactivity, and potential toxicity are influenced by its molecular structure, making it a subject of interest in chemical research and development. As with many fluorinated compounds, environmental persistence and bioaccumulation are important considerations in its application and regulation.

Formula: C₉H₆F₅NO₂

InChI: InChI=1S/C9H6F5NO2/c10-5-2-1-3-6(11)7(5)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16)

InChI key: InChIKey=WIBOUDXOABNVRK-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=C(F)C=CC=C1F

Synonyms:

• Carbamic acid, N-(2,6-difluorophenyl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(2,6-difluorophenyl)carbamate