CymitQuimica logo

CAS 1087797-96-3

:

2,2,2-Trifluoroethyl N-(2,6-dichloro-3-methylphenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(2,6-dichloro-3-methylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a white to off-white solid at room temperature and is known for its stability under standard conditions. It exhibits low solubility in water but is soluble in organic solvents, making it useful in various applications, particularly in agrochemicals and pharmaceuticals. The presence of the trifluoroethyl group imparts significant lipophilicity, enhancing its bioavailability and efficacy in biological systems. Additionally, the dichloro and methyl substituents on the aromatic ring contribute to its chemical reactivity and potential biological activity. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound's distinctive features make it a subject of interest in chemical research and development.
Formula:C10H8Cl2F3NO2
InChI:InChI=1S/C10H8Cl2F3NO2/c1-5-2-3-6(11)8(7(5)12)16-9(17)18-4-10(13,14)15/h2-3H,4H2,1H3,(H,16,17)
InChI key:InChIKey=MKGFZBUNKZVVLL-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(Cl)C(C)=CC=C1Cl
Synonyms:
  • 2,2,2-Trifluoroethyl N-(2,6-dichloro-3-methylphenyl)carbamate
  • Carbamic acid, N-(2,6-dichloro-3-methylphenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl 2,6-dichloro-3-methylphenylcarbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.