CAS 1087798-19-3

2,2,2-Trifluoroethyl N-(3,4-difluorophenyl)carbamate

Description:

2,2,2-Trifluoroethyl N-(3,4-difluorophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group attached to a difluorophenyl moiety. This compound is typically a white to off-white solid at room temperature and is known for its stability under standard conditions. It exhibits moderate solubility in organic solvents, which is influenced by the presence of the trifluoroethyl group that enhances its lipophilicity. The presence of multiple fluorine atoms contributes to its potential applications in agrochemicals and pharmaceuticals, as fluorinated compounds often exhibit enhanced biological activity and metabolic stability. Additionally, the carbamate functional group suggests potential use as a pesticide or herbicide, given its ability to interact with biological systems. Safety data should be consulted for handling and exposure risks, as fluorinated compounds can exhibit unique toxicological profiles. Overall, 2,2,2-Trifluoroethyl N-(3,4-difluorophenyl)carbamate represents a class of compounds with significant interest in chemical research and application.

Formula: C₉H₆F₅NO₂

InChI: InChI=1S/C9H6F5NO2/c10-6-2-1-5(3-7(6)11)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16)

InChI key: InChIKey=TULNFQINPCJPFU-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC(F)=C(F)C=C1

Synonyms:

• 2,2,2-Trifluoroethyl N-(3,4-difluorophenyl)carbamate
• Carbamic acid, N-(3,4-difluorophenyl)-, 2,2,2-trifluoroethyl ester