CAS 1087798-23-9

2,2,2-Trifluoroethyl N-[4-(acetylamino)phenyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[4-(acetylamino)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, reflecting its polar nature due to the presence of the carbamate moiety. The trifluoroethyl group imparts significant lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical applications. The acetylamino group enhances its potential for interactions with biological targets, suggesting possible uses in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the presence of both the carbamate and the aromatic ring, which can participate in various chemical reactions. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with fluorinated groups, which can pose environmental and health risks. Overall, this compound's unique characteristics make it a subject of interest in both research and application contexts.

Formula: C₁₁H₁₁F₃N₂O₃

InChI: InChI=1S/C11H11F3N2O3/c1-7(17)15-8-2-4-9(5-3-8)16-10(18)19-6-11(12,13)14/h2-5H,6H2,1H3,(H,15,17)(H,16,18)

InChI key: InChIKey=UMLPYVVDFWAAOR-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC=C(NC(C)=O)C=C1

Synonyms:

• 2,2,2-Trifluoroethyl N-(4-acetamidophenyl)carbamate
• 2,2,2-Trifluoroethyl N-[4-(acetylamino)phenyl]carbamate
• Carbamic acid, N-[4-(acetylamino)phenyl]-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-(4-acetamidophenyl)carbamate

CAS: 1087798-23-9

Versatile small molecule scaffold

Formula: C₁₁H₁₁F₃N₂O₃

Purity: Min. 95%

Molecular weight: 276.21 g/mol

Ref: 3D-MTB79823