CymitQuimica logo

CAS 1087798-48-8

:

3-Propyl-3-azabicyclo[3.2.1]octan-8-one

Description:
3-Propyl-3-azabicyclo[3.2.1]octan-8-one, identified by its CAS number 1087798-48-8, is a bicyclic compound featuring a nitrogen atom within its ring structure, classifying it as a bicyclic amine. This compound is characterized by its unique bicyclic framework, which consists of two fused cycloalkane rings and a nitrogen atom, contributing to its potential biological activity. The presence of a propyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The ketone functional group at the 8-position introduces reactivity, making it a candidate for various chemical transformations. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Additionally, the compound's stereochemistry may play a significant role in its pharmacological properties, affecting receptor binding and activity. Overall, 3-Propyl-3-azabicyclo[3.2.1]octan-8-one is a compound of interest for further research in organic synthesis and drug development.
Formula:C10H17NO
InChI:InChI=1S/C10H17NO/c1-2-5-11-6-8-3-4-9(7-11)10(8)12/h8-9H,2-7H2,1H3
InChI key:InChIKey=OWVPKAYXJLCICH-UHFFFAOYSA-N
SMILES:O=C1C2CN(CCC)CC1CC2
Synonyms:
  • 3-Propyl-3-azabicyclo[3.2.1]octan-8-one
  • 3-Azabicyclo[3.2.1]octan-8-one, 3-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.