CAS 108792-09-2

N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide

Description:

N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide, with the CAS number 108792-09-2, is a chemical compound characterized by its amide functional group and a substituted aromatic ring. The presence of the amino group (-NH2) and methoxy group (-OCH3) on the aromatic ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The dimethylpropanamide structure indicates that it has a branched aliphatic chain, which can influence its solubility and lipophilicity. This compound may exhibit properties such as moderate to high polarity due to the functional groups present, which can affect its interaction with biological targets. Additionally, the specific arrangement of substituents can lead to unique reactivity patterns and potential applications in pharmaceuticals or agrochemicals. Overall, the characteristics of this compound suggest it may play a role in various chemical and biological processes, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₈N₂O₂

InChI: InChI=1/C12H18N2O2/c1-12(2,3)11(15)14-9-6-5-8(13)7-10(9)16-4/h5-7H,13H2,1-4H3,(H,14,15)

SMILES: CC(C)(C)C(=Nc1ccc(cc1OC)N)O

N-(4-amino-2-methoxyphenyl)-2,2-dimethylpropanamide

CAS: 108792-09-2

Formula: C₁₂H₁₈N₂O₂

Purity: 95.0%

Molecular weight: 222.288

Ref: 10-F309996