CAS 108806-41-3: 3-[4-(carboxymethoxy)-3-{[4-(4-phenylbutoxy)benzoyl]amino}phenyl]propanoic acid
Description:3-[4-(Carboxymethoxy)-3-{[4-(4-phenylbutoxy)benzoyl]amino}phenyl]propanoic acid, with the CAS number 108806-41-3, is a complex organic compound characterized by its multi-functional structure. It features a carboxymethoxy group, which contributes to its solubility and potential reactivity, alongside a phenylbutoxy moiety that enhances its lipophilicity. The presence of an amino group linked to a benzoyl group suggests potential applications in medicinal chemistry, particularly in drug design, as it may interact with biological targets. The propanoic acid backbone indicates that it can participate in acid-base reactions, making it relevant in various chemical contexts. This compound may exhibit interesting biological activities due to its structural complexity, which could include anti-inflammatory or anticancer properties, although specific biological data would be necessary to confirm such activities. Overall, its unique combination of functional groups positions it as a potentially valuable compound in pharmaceutical research and development.
Formula:C28H29NO7
InChI:InChI=1/C28H29NO7/c30-26(31)16-10-21-9-15-25(36-19-27(32)33)24(18-21)29-28(34)22-11-13-23(14-12-22)35-17-5-4-8-20-6-2-1-3-7-20/h1-3,6-7,9,11-15,18H,4-5,8,10,16-17,19H2,(H,29,34)(H,30,31)(H,32,33)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | YM-17690 REF: TM-T29180CAS: 108806-41-3 | 98% | 904.00 €~2,375.00 € | Tue 17 Jun 25 |

YM-17690
Ref: TM-T29180
25mg | 1,444.00 € | ||
50mg | 1,882.00 € | ||
100mg | 2,375.00 € |