CAS 108827-19-6
:(R)-4-Amino-3-(naphthalen-1-yl)butanoic acid
Description:
(R)-4-Amino-3-(naphthalen-1-yl)butanoic acid, also known as (R)-naproxen, is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features a naphthalene ring, contributing to its hydrophobic characteristics, alongside an amino group and a carboxylic acid functional group, which are typical of amino acids. The presence of the naphthyl group enhances its potential for interactions with biological targets, making it of interest in pharmaceutical applications. The compound is typically solid at room temperature and is soluble in polar solvents, reflecting its amphipathic nature. Its chirality is significant in biological systems, as enantiomers can exhibit different pharmacological effects. (R)-4-Amino-3-(naphthalen-1-yl)butanoic acid is often studied for its role in neurotransmitter modulation and potential therapeutic applications, particularly in the context of neurological disorders. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C14H15NO2
InChI:InChI=1/C14H15NO2/c15-9-11(8-14(16)17)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9,15H2,(H,16,17)/t11-/m0/s1
SMILES:c1ccc2c(c1)cccc2[C@@H](CC(=O)O)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.