CAS 108846-90-8
:1,3,5-Triazin-2-amine,4-(chloromethyl)-6-(3,4-dihydro-1(2H)-quinolinyl)-
Description:
1,3,5-Triazin-2-amine, 4-(chloromethyl)-6-(3,4-dihydro-1(2H)-quinolinyl)-, identified by CAS number 108846-90-8, is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features a chloromethyl group, which enhances its reactivity, and a 3,4-dihydro-1(2H)-quinoline moiety, contributing to its potential biological activity. The presence of these functional groups suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a scaffold for drug development. The compound's structure indicates potential for interactions with biological targets, making it of interest in pharmaceutical research. Additionally, its synthesis and reactivity can be influenced by the electronic and steric effects of the substituents on the triazine and quinoline rings. Overall, this compound represents a unique combination of heterocyclic chemistry that may have applications in various fields, including agrochemicals and pharmaceuticals.
Formula:C13H14ClN5
InChI:InChI=1S/C13H14ClN5/c14-8-11-16-12(15)18-13(17-11)19-7-3-5-9-4-1-2-6-10(9)19/h1-2,4,6H,3,5,7-8H2,(H2,15,16,17,18)
InChI key:YFVGHUYNDXBRNV-UHFFFAOYSA-N
SMILES:C1CC2=CC=CC=C2N(C1)C3=NC(=NC(=N3)N)CCl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery