CymitQuimica logo

CAS 1088496-43-8

:

B-[6-(1-Hydroxy-1-methylethyl)-1-oxido-3-pyridinyl]boronic acid

Description:
B-[6-(1-Hydroxy-1-methylethyl)-1-oxido-3-pyridinyl]boronic acid, with the CAS number 1088496-43-8, is a boronic acid derivative characterized by its unique structural features, including a pyridine ring and a hydroxymethyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often involved in drug development. Additionally, the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity. The compound's boron atom is crucial for its chemical behavior, particularly in reactions involving nucleophiles. Overall, this substance is of interest in research fields focused on drug design and materials science due to its functional groups and potential reactivity.
Formula:C8H12BNO4
InChI:InChI=1S/C8H12BNO4/c1-8(2,11)7-4-3-6(9(12)13)5-10(7)14/h3-5,11-13H,1-2H3
InChI key:InChIKey=FBIFGWPXTUGZOE-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C=1N(=O)=CC(B(O)O)=CC1
Synonyms:
  • Boronic acid, B-[6-(1-hydroxy-1-methylethyl)-1-oxido-3-pyridinyl]-
  • B-[6-(1-Hydroxy-1-methylethyl)-1-oxido-3-pyridinyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.