CAS 108857-26-7

2-Amino-5-iodo-3-methylbenzaldehyde

Description:

2-Amino-5-iodo-3-methylbenzaldehyde is an organic compound characterized by the presence of an amino group (-NH2), an iodo substituent, and an aldehyde functional group (-CHO) on a benzene ring. The compound features a methyl group (-CH3) at the 3-position, an amino group at the 2-position, and an iodine atom at the 5-position of the aromatic ring. This structural arrangement contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the iodine atom can enhance the compound's electrophilicity, making it useful in various substitution reactions. Additionally, the amino group can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The compound's molecular structure suggests it may exhibit interesting biological activities, which could be explored in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and reactivity.

Formula: C₈H₈INO

InChI: InChI=1S/C8H8INO/c1-5-2-7(9)3-6(4-11)8(5)10/h2-4H,10H2,1H3

InChI key: InChIKey=YKULPUZMSGPMSV-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N)C(C)=CC(I)=C1

Synonyms:

• 2-Amino-5-iodo-3-methylbenzaldehyde
• Benzaldehyde, 2-amino-5-iodo-3-methyl-