CAS 108857-45-0
:1-(3-nitrophenyl)imidazolidin-2-one
Description:
1-(3-Nitrophenyl)imidazolidin-2-one is a chemical compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a carbonyl group. The presence of a nitrophenyl group at the 1-position introduces significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. This compound is typically a solid at room temperature and may exhibit yellow to orange coloration due to the nitro group. It is often used in organic synthesis and medicinal chemistry, where its unique structure can contribute to biological activity. The nitro group can also serve as a site for further chemical modifications, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be affected by the surrounding functional groups and the overall molecular environment. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous.
Formula:C9H9N3O3
InChI:InChI=1/C9H9N3O3/c13-9-10-4-5-11(9)7-2-1-3-8(6-7)12(14)15/h1-3,6H,4-5H2,(H,10,13)
SMILES:C1=CC(=CC(=C1)N(=O)=O)N1CCN=C1O
Synonyms:- 2-Imidazolidinone, 1-(3-Nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
