CAS 108861-20-7: 1,1'-(P-XYLYLENE)BIS(4,4'-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE)
Description:1,1'-(P-XYLYLENE)BIS(4,4'-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE), with the CAS number 108861-20-7, is a complex organic compound characterized by its unique structure, which includes a bis(bipyridinium) moiety linked by a p-xylylene bridge. This compound is typically a salt, as indicated by the presence of hexafluorophosphate anions, which are known for their stability and ability to solvate cations effectively. The bipyridinium units contribute to the compound's potential as a ligand in coordination chemistry, while the hexafluorophosphate anions enhance its solubility in polar solvents. The overall structure imparts interesting electrochemical properties, making it suitable for applications in organic electronics, such as in the development of ionic liquids or as a component in electrochemical devices. Additionally, the presence of multiple nitrogen atoms in the bipyridinium structure may facilitate interactions with various substrates, enhancing its utility in catalysis and material science. Overall, this compound exemplifies the intersection of organic synthesis and materials chemistry.
Formula:C28H24F12N4P2
InChI:InChI=1/C28H24N4.2F6P/c1-2-24(22-32-19-11-28(12-20-32)26-7-15-30-16-8-26)4-3-23(1)21-31-17-9-27(10-18-31)25-5-13-29-14-6-25;2*1-7(2,3,4,5)6/h1-20H,21-22H2;;/q+2;2*-1
- Synonyms:
- 1,1'-[1,4-Phenylenebis(Methylene)]Bis(4,4'-Bipyridinium) Bis(Hexafluorophosphate)
- 1,1'-[1,4-Phenylenebis(methylene)]bis(4,4'-biprridinium)bis(hexafluorophosphate)
- 1,1'-(Benzene-1,4-Diyldimethanediyl)Bis[4-(Pyridin-4-Yl)Pyridinium] Dihexafluorophosphate
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1,1'-[1,4-Phenylenebis(methylene)]bis(4,4'-bipyridinium) Bis(hexafluorophosphate)
Ref: 3B-P1407
1g | 651.00 € | ||
100mg | 105.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1,1-(P-XYLYLENE)BIS(4,4-BIPYRIDINIUM) BIS(HEXAFLUOROPHOSPHATE)
Ref: IN-DA003D4W
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1,1'-[1,4-Phenylenebis(Methylene)]Bis[4-(4-Pyridinyl)Pyridinium] Dihexafluorophosphate
Ref: 3D-FP101279
10g | Discontinued | Request information | |
25g | Discontinued | Request information |