CymitQuimica logo

CAS 108865-79-8

:

2-Oxetanecarboxylic acid, 3-amino-, (2R-trans)-

Description:
2-Oxetanecarboxylic acid, 3-amino-, (2R-trans)-, also known by its CAS number 108865-79-8, is a chemical compound characterized by its unique cyclic structure and functional groups. This compound features a four-membered oxetane ring, which contributes to its reactivity and stability. The presence of a carboxylic acid group (-COOH) indicates that it can participate in acid-base reactions and can act as a proton donor. Additionally, the amino group (-NH2) at the 3-position of the oxetane ring suggests that it can engage in nucleophilic reactions and form hydrogen bonds, enhancing its solubility in polar solvents. The (2R-trans) configuration denotes specific stereochemistry, which can influence the compound's biological activity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or organic synthesis due to its structural features and functional groups, making it a subject of interest in medicinal chemistry and related fields.
Formula:C4H7NO3
InChI:InChI=1S/C4H7NO3/c5-2-1-8-3(2)4(6)7/h2-3H,1,5H2,(H,6,7)/t2-,3-/m1/s1
InChI key:InChIKey=UTIYGJDWWLIDQY-PWNYCUMCSA-N
SMILES:C(O)(=O)[C@H]1[C@H](N)CO1
Synonyms:
  • 2-Oxetanecarboxylic acid, 3-amino-, (2R-trans)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.