CymitQuimica logo

CAS 108865-80-1

:

(2S,3S)-3-Amino-2-oxetanecarboxylic acid

Description:
(2S,3S)-3-Amino-2-oxetanecarboxylic acid, also known as a cyclic amino acid, is characterized by its unique four-membered oxetane ring structure, which contributes to its distinct chemical properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), making it an α-amino acid. The stereochemistry indicated by the (2S,3S) configuration suggests that it has specific spatial arrangements of its substituents, which can influence its biological activity and interactions. The presence of the oxetane ring can impart rigidity to the molecule, potentially affecting its conformation and reactivity. This compound may exhibit properties such as solubility in polar solvents and the ability to participate in various chemical reactions typical of amino acids, including peptide bond formation. Its unique structure makes it of interest in medicinal chemistry and the development of pharmaceuticals, particularly in the design of novel compounds with specific biological functions. Overall, (2S,3S)-3-Amino-2-oxetanecarboxylic acid represents a fascinating area of study within organic and medicinal chemistry.
Formula:C4H7NO3
InChI:InChI=1S/C4H7NO3/c5-2-1-8-3(2)4(6)7/h2-3H,1,5H2,(H,6,7)/t2-,3-/m0/s1
InChI key:InChIKey=UTIYGJDWWLIDQY-HRFVKAFMSA-N
SMILES:C(O)(=O)[C@@H]1[C@@H](N)CO1
Synonyms:
  • (2S,3S)-3-Amino-2-oxetanecarboxylic acid
  • 2-Oxetanecarboxylic acid, 3-amino-, (2S,3S)-
  • 2-Oxetanecarboxylic acid, 3-amino-, (2S-trans)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.