CAS 108885-69-4
:16,24-Cycloergost-22-en-26-oic acid, 1,11,12-tris(acetyloxy)-2,3-epoxy-7,15,23,25-tetrahydroxy-6-oxo-, γ-lactone, (1α,2α,3α,5α,7β,11α,12α,15α,16β,24β,25S)-
Description:
The chemical substance known as "16,24-Cycloergost-22-en-26-oic acid, 1,11,12-tris(acetyloxy)-2,3-epoxy-7,15,23,25-tetrahydroxy-6-oxo-, γ-lactone, (1α,2α,3α,5α,7β,11α,12α,15α,16β,24β,25S)-" with CAS number 108885-69-4 is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a cycloergostane backbone, which is a steroid-like structure, and includes multiple hydroxyl (-OH) groups, acetoxy (-OCOCH3) groups, and an epoxy group, contributing to its reactivity and potential biological activity. The presence of a γ-lactone indicates a cyclic ester formation, which can influence its solubility and interaction with biological systems. The specific stereochemistry, denoted by the various alpha and beta configurations, suggests that this compound may exhibit unique pharmacological properties, potentially making it of interest in medicinal chemistry. Its structural complexity and functional groups imply that it could participate in various chemical reactions, making it a subject of study for its potential applications in pharmaceuticals or biochemistry.
Formula:C34H44O13
InChI:InChI=1S/C34H44O13/c1-11-9-17-33(7,34(8,42)30(41)47-17)22-19(11)32(6)20(25(22)40)18-21(27(43-12(2)35)29(32)45-14(4)37)31(5)15(23(38)24(18)39)10-16-26(46-16)28(31)44-13(3)36/h9,11,15-16,18-22,24-29,39-40,42H,10H2,1-8H3/t11-,15-,16+,18+,19+,20-,21-,22+,24-,25-,26+,27+,28+,29+,31+,32-,33+,34-/m1/s1
InChI key:InChIKey=FFQOXBQSZPYHSA-MPOUNFKCSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)([C@@H](OC(C)=O)[C@H]3OC(C)=O)[C@@]5([C@@]([C@@H]4O)([C@]6(C)C(=C[C@H]5C)OC(=O)[C@@]6(C)O)[H])[H])[H])([C@@H](O)C(=O)[C@]1(C[C@]7([C@@]([C@@H]2OC(C)=O)(O7)[H])[H])[H])[H])[H]
Synonyms:- 15-O-Deacetyltaccalonolide A
- 16,24-Cycloergost-22-en-26-oic acid, 1,11,12-tris(acetyloxy)-2,3-epoxy-7,15,23,25-tetrahydroxy-6-oxo-, γ-lactone, (1α,2α,3α,5α,7β,11α,12α,15α,16β,24β,25S)-
- 2H-Oxireno[6',7']naphtho[1',2':7,8]fluoreno[2,1-b]furan,16,24-cycloergost-22-en-26-oic acid deriv.
- Taccalonolide B
- (1alpha,2alpha,3alpha,5alpha,7beta,11alpha,12alpha,15alpha,16beta,24beta,25S)-1,11,12-Tris(acetyloxy)-2,3-epoxy-7,15,23,25-tetrahydroxy-6-oxo-16,24-cycloergost-22-en-26-oic acid gamma-lactone
- ETaccalonolide B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Taccalonolide B
CAS:Taccalonolide B is effective in vitro against cell lines that overexpress P-glycoprotein (Pgp) and multidrug-resistance protein (MRP7).Formula:C34H44O13Purity:99.85%Color and Shape:SolidMolecular weight:660.71Taccalonolide B
CAS:<p>Taccalonolide B is a bitter substance that belongs to the genus Taccalonopsis. The major cytotoxic activity of this substance has been shown in a number of cellular and animal studies, where it was found to induce apoptosis in cancer cells. Taccalonolide B also showed anticancer activity against drug-resistant cells. This substance has potential for use as a cancer therapy because it induces cell death in a variety of cancers, including lung, breast and prostate cancers. Taccalonolide B is an anticancer agent that inhibits the proliferation of cancer cells by interfering with the function of DNA topoisomerase II. It binds to DNA topoisomerase II and prevents its normal function, which may lead to cell death through inhibition of DNA replication and transcription.</p>Formula:C34H44O13Purity:Min. 95%Molecular weight:660.7 g/mol




