CAS 108894-40-2

Brolaconazole

Description:

Brolaconazole is a synthetic fungicide belonging to the triazole class, primarily used in agriculture for the control of various fungal diseases in crops. Its chemical structure features a triazole ring, which is characteristic of many fungicides, allowing it to inhibit the biosynthesis of ergosterol, an essential component of fungal cell membranes. This mechanism of action effectively disrupts fungal growth and reproduction. Brolaconazole is known for its systemic properties, enabling it to be absorbed and translocated within plants, providing protective effects against pathogens. It exhibits a broad spectrum of activity against several fungal species, making it valuable in crop protection. Additionally, Brolaconazole is characterized by its relatively low toxicity to mammals and beneficial organisms, which is an important consideration in integrated pest management practices. Its stability and efficacy under various environmental conditions further enhance its utility in agricultural applications. As with all chemical substances, proper handling and adherence to safety guidelines are essential to minimize any potential risks associated with its use.

Formula: C₁₇H₁₅BrN₂

InChI: InChI=1/C17H15BrN2/c18-16-8-6-15(7-9-16)17(12-20-11-10-19-13-20)14-4-2-1-3-5-14/h1-11,13,17H,12H2

Synonyms:

• UNII-6CHG505391
• (+-)-1-(p-Bromo-beta-phenylphenethyl)imidazole
• ( -)-1-(p-Bromo-beta-phenylphenethyl)imidazole.
• Brolaconazole [INN]
• 1-[2-(4-bromophenyl)-2-phenylethyl]-1H-imidazole

(1R,2S)-Xeruborbactam disodium

CAS: 108894-40-2

(1R,2S)-Xeruborbactam disodium

Purity: ≥98%

Molecular weight: 283.96g/mol

Ref: 54-BUP20362